C25H31ClN6O4 — CID 90252212
[(1R,2S,4R,6R)-4-[3-[(2-chloroimidazo[1,5-b]pyridazin-7-yl)amino]-4-pyridinyl]-2-methyl-6-[(2-methylpropan-2-yl)oxycarbonylamino]cyclohexyl] acetate (PubChem CID 90252212) has the molecular formula C25H31ClN6O4 and a molecular weight of 515.01 g/mol. Its IUPAC name is [(1R,2S,4R,6R)-4-[3-[(2-chloroimidazo[1,5-b]pyridazin-7-yl)amino]-4-pyridinyl]-2-methyl-6-[(2-methylpropan-2-yl)oxycarbonylamino]cyclohexyl] acetate.
| Compound Name | [(1R,2S,4R,6R)-4-[3-[(2-chloroimidazo[1,5-b]pyridazin-7-yl)amino]-4-pyridinyl]-2-methyl-6-[(2-methylpropan-2-yl)oxycarbonylamino]cyclohexyl] acetate |
|---|---|
| PubChem CID | 90252212 |
| Molecular Formula | C25H31ClN6O4 |
| Molecular Weight | 515.01 g/mol |
| Exact Mass | 514.21 |
| IUPAC Name | [(1R,2S,4R,6R)-4-[3-[(2-chloroimidazo[1,5-b]pyridazin-7-yl)amino]-4-pyridinyl]-2-methyl-6-[(2-methylpropan-2-yl)oxycarbonylamino]cyclohexyl] acetate |
| SMILES | CC(=O)O[C@@H]1[C@@H](C)C[C@@H](c2ccncc2Nc2ncc3ccc(Cl)nn23)C[C@H]1NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C25H31ClN6O4/c1-14-10-16(11-19(22(14)35-15(2)33)30-24(34)36-25(3,4)5)18-8-9-27-13-20(18)29-23-28-12-17-6-7-21(26)31-32(17)23/h6-9,12-14,16,19,22H,10-11H2,1-5H3,(H,28,29)(H,30,34)/t14-,16+,19+,22+/m0/s1 |
| InChIKey | KOJQZGFBSHCZBG-LCFVAKEKSA-N |
| XLogP | 4.86 |
| TPSA | 119.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.01 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |