C27H30F2N6O2 — CID 90252142
2-[4-[7-[[4-[(1R,3R,4R,5S)-3-amino-4-methoxy-5-methylcyclohexyl]-3-pyridinyl]amino]imidazo[1,5-b]pyridazin-2-yl]-3,5-difluorophenyl]ethanol (PubChem CID 90252142) has the molecular formula C27H30F2N6O2 and a molecular weight of 508.57 g/mol. Its IUPAC name is 2-[4-[7-[[4-[(1R,3R,4R,5S)-3-amino-4-methoxy-5-methylcyclohexyl]-3-pyridinyl]amino]imidazo[1,5-b]pyridazin-2-yl]-3,5-difluorophenyl]ethanol.
| Compound Name | 2-[4-[7-[[4-[(1R,3R,4R,5S)-3-amino-4-methoxy-5-methylcyclohexyl]-3-pyridinyl]amino]imidazo[1,5-b]pyridazin-2-yl]-3,5-difluorophenyl]ethanol |
|---|---|
| PubChem CID | 90252142 |
| Molecular Formula | C27H30F2N6O2 |
| Molecular Weight | 508.57 g/mol |
| Exact Mass | 508.24 |
| IUPAC Name | 2-[4-[7-[[4-[(1R,3R,4R,5S)-3-amino-4-methoxy-5-methylcyclohexyl]-3-pyridinyl]amino]imidazo[1,5-b]pyridazin-2-yl]-3,5-difluorophenyl]ethanol |
| SMILES | CO[C@H]1[C@H](N)C[C@H](c2ccncc2Nc2ncc3ccc(-c4c(F)cc(CCO)cc4F)nn23)C[C@@H]1C |
| InChI | InChI=1S/C27H30F2N6O2/c1-15-9-17(12-22(30)26(15)37-2)19-5-7-31-14-24(19)33-27-32-13-18-3-4-23(34-35(18)27)25-20(28)10-16(6-8-36)11-21(25)29/h3-5,7,10-11,13-15,17,22,26,36H,6,8-9,12,30H2,1-2H3,(H,32,33)/t15-,17+,22+,26+/m0/s1 |
| InChIKey | CWULODHEZFKAFZ-LGJLOKMGSA-N |
| XLogP | 4.20 |
| TPSA | 110.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.57 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |