C29H33F2N7O2 — CID 90252610
N-[(1S,2R,4R,6S)-2-amino-4-[3-[[2-[2,6-difluoro-4-(2-hydroxyethyl)phenyl]imidazo[1,5-b]pyridazin-7-yl]amino]-4-pyridinyl]-6-methylcyclohexyl]-N-methylacetamide (PubChem CID 90252610) has the molecular formula C29H33F2N7O2 and a molecular weight of 549.63 g/mol. Its IUPAC name is N-[(1S,2R,4R,6S)-2-amino-4-[3-[[2-[2,6-difluoro-4-(2-hydroxyethyl)phenyl]imidazo[1,5-b]pyridazin-7-yl]amino]-4-pyridinyl]-6-methylcyclohexyl]-N-methylacetamide.
| Compound Name | N-[(1S,2R,4R,6S)-2-amino-4-[3-[[2-[2,6-difluoro-4-(2-hydroxyethyl)phenyl]imidazo[1,5-b]pyridazin-7-yl]amino]-4-pyridinyl]-6-methylcyclohexyl]-N-methylacetamide |
|---|---|
| PubChem CID | 90252610 |
| Molecular Formula | C29H33F2N7O2 |
| Molecular Weight | 549.63 g/mol |
| Exact Mass | 549.27 |
| IUPAC Name | N-[(1S,2R,4R,6S)-2-amino-4-[3-[[2-[2,6-difluoro-4-(2-hydroxyethyl)phenyl]imidazo[1,5-b]pyridazin-7-yl]amino]-4-pyridinyl]-6-methylcyclohexyl]-N-methylacetamide |
| SMILES | CC(=O)N(C)[C@@H]1[C@H](N)C[C@H](c2ccncc2Nc2ncc3ccc(-c4c(F)cc(CCO)cc4F)nn23)C[C@@H]1C |
| InChI | InChI=1S/C29H33F2N7O2/c1-16-10-19(13-24(32)28(16)37(3)17(2)40)21-6-8-33-15-26(21)35-29-34-14-20-4-5-25(36-38(20)29)27-22(30)11-18(7-9-39)12-23(27)31/h4-6,8,11-12,14-16,19,24,28,39H,7,9-10,13,32H2,1-3H3,(H,34,35)/t16-,19+,24+,28-/m0/s1 |
| InChIKey | YSEFKGNQCSACRY-YBIMPLTISA-N |
| XLogP | 4.04 |
| TPSA | 121.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.63 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |