C30H33F3N4O3S — CID 86705217
tert-butyl N-[(1R,2S,3S,5R)-5-[3-[[6-(2,6-difluorophenyl)-5-fluoropyridine-2-carbonyl]amino]-4-pyridinyl]-3-methyl-2-methylsulfanylcyclohexyl]carbamate (PubChem CID 86705217) has the molecular formula C30H33F3N4O3S and a molecular weight of 586.68 g/mol. Its IUPAC name is tert-butyl N-[(1R,2S,3S,5R)-5-[3-[[6-(2,6-difluorophenyl)-5-fluoropyridine-2-carbonyl]amino]-4-pyridinyl]-3-methyl-2-methylsulfanylcyclohexyl]carbamate.
| Compound Name | tert-butyl N-[(1R,2S,3S,5R)-5-[3-[[6-(2,6-difluorophenyl)-5-fluoropyridine-2-carbonyl]amino]-4-pyridinyl]-3-methyl-2-methylsulfanylcyclohexyl]carbamate |
|---|---|
| PubChem CID | 86705217 |
| Molecular Formula | C30H33F3N4O3S |
| Molecular Weight | 586.68 g/mol |
| Exact Mass | 586.22 |
| IUPAC Name | tert-butyl N-[(1R,2S,3S,5R)-5-[3-[[6-(2,6-difluorophenyl)-5-fluoropyridine-2-carbonyl]amino]-4-pyridinyl]-3-methyl-2-methylsulfanylcyclohexyl]carbamate |
| SMILES | CS[C@H]1[C@@H](C)C[C@@H](c2ccncc2NC(=O)c2ccc(F)c(-c3c(F)cccc3F)n2)C[C@H]1NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C30H33F3N4O3S/c1-16-13-17(14-23(27(16)41-5)37-29(39)40-30(2,3)4)18-11-12-34-15-24(18)36-28(38)22-10-9-21(33)26(35-22)25-19(31)7-6-8-20(25)32/h6-12,15-17,23,27H,13-14H2,1-5H3,(H,36,38)(H,37,39)/t16-,17+,23+,27-/m0/s1 |
| InChIKey | LKHJADGTLUJMDL-SQMLSJJLSA-N |
| XLogP | 6.95 |
| TPSA | 93.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.68 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |