C23H28BrFN4O3 — CID 123260345
tert-butyl N-[(1R,3R,5R)-3-[3-[(6-bromo-5-fluoropyridine-2-carbonyl)amino]-4-pyridinyl]-5-methylcyclohexyl]carbamate (PubChem CID 123260345) has the molecular formula C23H28BrFN4O3 and a molecular weight of 507.40 g/mol. Its IUPAC name is tert-butyl N-[(1R,3R,5R)-3-[3-[(6-bromo-5-fluoropyridine-2-carbonyl)amino]-4-pyridinyl]-5-methylcyclohexyl]carbamate.
| Compound Name | tert-butyl N-[(1R,3R,5R)-3-[3-[(6-bromo-5-fluoropyridine-2-carbonyl)amino]-4-pyridinyl]-5-methylcyclohexyl]carbamate |
|---|---|
| PubChem CID | 123260345 |
| Molecular Formula | C23H28BrFN4O3 |
| Molecular Weight | 507.40 g/mol |
| Exact Mass | 506.13 |
| IUPAC Name | tert-butyl N-[(1R,3R,5R)-3-[3-[(6-bromo-5-fluoropyridine-2-carbonyl)amino]-4-pyridinyl]-5-methylcyclohexyl]carbamate |
| SMILES | C[C@H]1C[C@@H](NC(=O)OC(C)(C)C)C[C@H](c2ccncc2NC(=O)c2ccc(F)c(Br)n2)C1 |
| InChI | InChI=1S/C23H28BrFN4O3/c1-13-9-14(11-15(10-13)27-22(31)32-23(2,3)4)16-7-8-26-12-19(16)29-21(30)18-6-5-17(25)20(24)28-18/h5-8,12-15H,9-11H2,1-4H3,(H,27,31)(H,29,30)/t13-,14-,15-/m1/s1 |
| InChIKey | POHRUBPTRZGVOK-RBSFLKMASA-N |
| XLogP | 5.43 |
| TPSA | 93.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.40 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|