C14H17N3O3S — CID 89157826
tert-butyl 3-[(3-isothiocyanato-4-pyridinyl)oxy]azetidine-1-carboxylate (PubChem CID 89157826) has the molecular formula C14H17N3O3S and a molecular weight of 307.38 g/mol. Its IUPAC name is tert-butyl 3-[(3-isothiocyanato-4-pyridinyl)oxy]azetidine-1-carboxylate.
| Compound Name | tert-butyl 3-[(3-isothiocyanato-4-pyridinyl)oxy]azetidine-1-carboxylate |
|---|---|
| PubChem CID | 89157826 |
| Molecular Formula | C14H17N3O3S |
| Molecular Weight | 307.38 g/mol |
| Exact Mass | 307.10 |
| IUPAC Name | tert-butyl 3-[(3-isothiocyanato-4-pyridinyl)oxy]azetidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC(Oc2ccncc2N=C=S)C1 |
| InChI | InChI=1S/C14H17N3O3S/c1-14(2,3)20-13(18)17-7-10(8-17)19-12-4-5-15-6-11(12)16-9-21/h4-6,10H,7-8H2,1-3H3 |
| InChIKey | QRTOMFYVHUDITR-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 64.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.38 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|