C29H38N4O6S — CID 158707690
tert-butyl 3-(4-aminophenoxy)azetidine-1-carboxylate;tert-butyl 3-(4-isothiocyanatophenoxy)azetidine-1-carboxylate (PubChem CID 158707690) has the molecular formula C29H38N4O6S and a molecular weight of 570.71 g/mol. Its IUPAC name is tert-butyl 3-(4-aminophenoxy)azetidine-1-carboxylate;tert-butyl 3-(4-isothiocyanatophenoxy)azetidine-1-carboxylate.
| Compound Name | tert-butyl 3-(4-aminophenoxy)azetidine-1-carboxylate;tert-butyl 3-(4-isothiocyanatophenoxy)azetidine-1-carboxylate |
|---|---|
| PubChem CID | 158707690 |
| Molecular Formula | C29H38N4O6S |
| Molecular Weight | 570.71 g/mol |
| Exact Mass | 570.25 |
| IUPAC Name | tert-butyl 3-(4-aminophenoxy)azetidine-1-carboxylate;tert-butyl 3-(4-isothiocyanatophenoxy)azetidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC(Oc2ccc(N)cc2)C1.CC(C)(C)OC(=O)N1CC(Oc2ccc(N=C=S)cc2)C1 |
| InChI | InChI=1S/C15H18N2O3S.C14H20N2O3/c1-15(2,3)20-14(18)17-8-13(9-17)19-12-6-4-11(5-7-12)16-10-21;1-14(2,3)19-13(17)16-8-12(9-16)18-11-6-4-10(15)5-7-11/h4-7,13H,8-9H2,1-3H3;4-7,12H,8-9,15H2,1-3H3 |
| InChIKey | IIIAZZIYCOSYRE-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 115.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.71 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|