C14H17N3O3 — CID 162385936
tert-butyl 3-[(6-cyano-3-pyridinyl)oxy]azetidine-1-carboxylate (PubChem CID 162385936) has the molecular formula C14H17N3O3 and a molecular weight of 275.31 g/mol. Its IUPAC name is tert-butyl 3-[(6-cyano-3-pyridinyl)oxy]azetidine-1-carboxylate.
| Compound Name | tert-butyl 3-[(6-cyano-3-pyridinyl)oxy]azetidine-1-carboxylate |
|---|---|
| PubChem CID | 162385936 |
| Molecular Formula | C14H17N3O3 |
| Molecular Weight | 275.31 g/mol |
| Exact Mass | 275.13 |
| IUPAC Name | tert-butyl 3-[(6-cyano-3-pyridinyl)oxy]azetidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC(Oc2ccc(C#N)nc2)C1 |
| InChI | InChI=1S/C14H17N3O3/c1-14(2,3)20-13(18)17-8-12(9-17)19-11-5-4-10(6-15)16-7-11/h4-5,7,12H,8-9H2,1-3H3 |
| InChIKey | PYYUYIBLAYNWAS-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 75.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.31 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |