C14H17N3O4S — CID 155230392
tert-butyl 3-[(6-cyano-3-pyridinyl)sulfonyl]azetidine-1-carboxylate (PubChem CID 155230392) has the molecular formula C14H17N3O4S and a molecular weight of 323.37 g/mol. Its IUPAC name is tert-butyl 3-[(6-cyano-3-pyridinyl)sulfonyl]azetidine-1-carboxylate.
| Compound Name | tert-butyl 3-[(6-cyano-3-pyridinyl)sulfonyl]azetidine-1-carboxylate |
|---|---|
| PubChem CID | 155230392 |
| Molecular Formula | C14H17N3O4S |
| Molecular Weight | 323.37 g/mol |
| Exact Mass | 323.09 |
| IUPAC Name | tert-butyl 3-[(6-cyano-3-pyridinyl)sulfonyl]azetidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC(S(=O)(=O)c2ccc(C#N)nc2)C1 |
| InChI | InChI=1S/C14H17N3O4S/c1-14(2,3)21-13(18)17-8-12(9-17)22(19,20)11-5-4-10(6-15)16-7-11/h4-5,7,12H,8-9H2,1-3H3 |
| InChIKey | NRRVXJDBQTXTSN-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 100.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.37 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |