C15H20N4O2 — CID 169219644
tert-butyl 3-[(5-cyano-2-pyridinyl)-methylamino]azetidine-1-carboxylate (PubChem CID 169219644) has the molecular formula C15H20N4O2 and a molecular weight of 288.35 g/mol. Its IUPAC name is tert-butyl 3-[(5-cyano-2-pyridinyl)-methylamino]azetidine-1-carboxylate.
| Compound Name | tert-butyl 3-[(5-cyano-2-pyridinyl)-methylamino]azetidine-1-carboxylate |
|---|---|
| PubChem CID | 169219644 |
| Molecular Formula | C15H20N4O2 |
| Molecular Weight | 288.35 g/mol |
| Exact Mass | 288.16 |
| IUPAC Name | tert-butyl 3-[(5-cyano-2-pyridinyl)-methylamino]azetidine-1-carboxylate |
| SMILES | CN(c1ccc(C#N)cn1)C1CN(C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C15H20N4O2/c1-15(2,3)21-14(20)19-9-12(10-19)18(4)13-6-5-11(7-16)8-17-13/h5-6,8,12H,9-10H2,1-4H3 |
| InChIKey | VQVDIHUZYJUQRP-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 69.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.35 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |