C18H24N4O2 — CID 66766463
tert-butyl (3R)-3-[(5-cyano-2-pyridinyl)-cyclopropylamino]pyrrolidine-1-carboxylate (PubChem CID 66766463) has the molecular formula C18H24N4O2 and a molecular weight of 328.42 g/mol. Its IUPAC name is tert-butyl (3R)-3-[(5-cyano-2-pyridinyl)-cyclopropylamino]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (3R)-3-[(5-cyano-2-pyridinyl)-cyclopropylamino]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 66766463 |
| Molecular Formula | C18H24N4O2 |
| Molecular Weight | 328.42 g/mol |
| Exact Mass | 328.19 |
| IUPAC Name | tert-butyl (3R)-3-[(5-cyano-2-pyridinyl)-cyclopropylamino]pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC[C@@H](N(c2ccc(C#N)cn2)C2CC2)C1 |
| InChI | InChI=1S/C18H24N4O2/c1-18(2,3)24-17(23)21-9-8-15(12-21)22(14-5-6-14)16-7-4-13(10-19)11-20-16/h4,7,11,14-15H,5-6,8-9,12H2,1-3H3/t15-/m1/s1 |
| InChIKey | RLFQKUDCQKQTIC-OAHLLOKOSA-N |
| XLogP | 2.93 |
| TPSA | 69.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.42 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |