C13H18N4O2 — CID 172557595
tert-butyl (3S)-3-(4-cyanopyrazol-1-yl)pyrrolidine-1-carboxylate (PubChem CID 172557595) has the molecular formula C13H18N4O2 and a molecular weight of 262.31 g/mol. Its IUPAC name is tert-butyl (3S)-3-(4-cyanopyrazol-1-yl)pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (3S)-3-(4-cyanopyrazol-1-yl)pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 172557595 |
| Molecular Formula | C13H18N4O2 |
| Molecular Weight | 262.31 g/mol |
| Exact Mass | 262.14 |
| IUPAC Name | tert-butyl (3S)-3-(4-cyanopyrazol-1-yl)pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC[C@H](n2cc(C#N)cn2)C1 |
| InChI | InChI=1S/C13H18N4O2/c1-13(2,3)19-12(18)16-5-4-11(9-16)17-8-10(6-14)7-15-17/h7-8,11H,4-5,9H2,1-3H3/t11-/m0/s1 |
| InChIKey | GUEHPQXRCNBRCY-NSHDSACASA-N |
| XLogP | 1.94 |
| TPSA | 71.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.31 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |