C21H26N4O2 — CID 170855204
tert-butyl 4-[4-(4-cyano-2-methylphenyl)pyrazol-1-yl]piperidine-1-carboxylate (PubChem CID 170855204) has the molecular formula C21H26N4O2 and a molecular weight of 366.47 g/mol. Its IUPAC name is tert-butyl 4-[4-(4-cyano-2-methylphenyl)pyrazol-1-yl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[4-(4-cyano-2-methylphenyl)pyrazol-1-yl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 170855204 |
| Molecular Formula | C21H26N4O2 |
| Molecular Weight | 366.47 g/mol |
| Exact Mass | 366.21 |
| IUPAC Name | tert-butyl 4-[4-(4-cyano-2-methylphenyl)pyrazol-1-yl]piperidine-1-carboxylate |
| SMILES | Cc1cc(C#N)ccc1-c1cnn(C2CCN(C(=O)OC(C)(C)C)CC2)c1 |
| InChI | InChI=1S/C21H26N4O2/c1-15-11-16(12-22)5-6-19(15)17-13-23-25(14-17)18-7-9-24(10-8-18)20(26)27-21(2,3)4/h5-6,11,13-14,18H,7-10H2,1-4H3 |
| InChIKey | OHNZWQKMKLZGSV-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 71.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.47 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |