C21H24F3N3O3 — CID 172994038
tert-butyl 4-[4-[4-formyl-2-(trifluoromethyl)phenyl]pyrazol-1-yl]piperidine-1-carboxylate (PubChem CID 172994038) has the molecular formula C21H24F3N3O3 and a molecular weight of 423.44 g/mol. Its IUPAC name is tert-butyl 4-[4-[4-formyl-2-(trifluoromethyl)phenyl]pyrazol-1-yl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[4-[4-formyl-2-(trifluoromethyl)phenyl]pyrazol-1-yl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 172994038 |
| Molecular Formula | C21H24F3N3O3 |
| Molecular Weight | 423.44 g/mol |
| Exact Mass | 423.18 |
| IUPAC Name | tert-butyl 4-[4-[4-formyl-2-(trifluoromethyl)phenyl]pyrazol-1-yl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(n2cc(-c3ccc(C=O)cc3C(F)(F)F)cn2)CC1 |
| InChI | InChI=1S/C21H24F3N3O3/c1-20(2,3)30-19(29)26-8-6-16(7-9-26)27-12-15(11-25-27)17-5-4-14(13-28)10-18(17)21(22,23)24/h4-5,10-13,16H,6-9H2,1-3H3 |
| InChIKey | BXWJESKDISTIRU-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 64.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.44 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|