C18H31N5O2 — CID 169092669
tert-butyl 4-[4-(4-methylpiperazin-1-yl)pyrazol-1-yl]piperidine-1-carboxylate (PubChem CID 169092669) has the molecular formula C18H31N5O2 and a molecular weight of 349.48 g/mol. Its IUPAC name is tert-butyl 4-[4-(4-methylpiperazin-1-yl)pyrazol-1-yl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[4-(4-methylpiperazin-1-yl)pyrazol-1-yl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 169092669 |
| Molecular Formula | C18H31N5O2 |
| Molecular Weight | 349.48 g/mol |
| Exact Mass | 349.25 |
| IUPAC Name | tert-butyl 4-[4-(4-methylpiperazin-1-yl)pyrazol-1-yl]piperidine-1-carboxylate |
| SMILES | CN1CCN(c2cnn(C3CCN(C(=O)OC(C)(C)C)CC3)c2)CC1 |
| InChI | InChI=1S/C18H31N5O2/c1-18(2,3)25-17(24)22-7-5-15(6-8-22)23-14-16(13-19-23)21-11-9-20(4)10-12-21/h13-15H,5-12H2,1-4H3 |
| InChIKey | BBBDKDQLOBDIGF-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 53.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.48 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |