C23H40BN3O4 — CID 171392913
tert-butyl 4-[4-(4,4,5,5-tetraethyl-1,3,2-dioxaborolan-2-yl)pyrazol-1-yl]piperidine-1-carboxylate (PubChem CID 171392913) has the molecular formula C23H40BN3O4 and a molecular weight of 433.40 g/mol. Its IUPAC name is tert-butyl 4-[4-(4,4,5,5-tetraethyl-1,3,2-dioxaborolan-2-yl)pyrazol-1-yl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[4-(4,4,5,5-tetraethyl-1,3,2-dioxaborolan-2-yl)pyrazol-1-yl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 171392913 |
| Molecular Formula | C23H40BN3O4 |
| Molecular Weight | 433.40 g/mol |
| Exact Mass | 433.31 |
| IUPAC Name | tert-butyl 4-[4-(4,4,5,5-tetraethyl-1,3,2-dioxaborolan-2-yl)pyrazol-1-yl]piperidine-1-carboxylate |
| SMILES | CCC1(CC)OB(c2cnn(C3CCN(C(=O)OC(C)(C)C)CC3)c2)OC1(CC)CC |
| InChI | InChI=1S/C23H40BN3O4/c1-8-22(9-2)23(10-3,11-4)31-24(30-22)18-16-25-27(17-18)19-12-14-26(15-13-19)20(28)29-21(5,6)7/h16-17,19H,8-15H2,1-7H3 |
| InChIKey | XDMOKOKVWLKWOI-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 65.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.40 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|