C48H81B3N8O8 — CID 158230796
tert-butyl 4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazol-1-yl]cyclohexane-1-carboxylate;bis(4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazol-1-yl]piperidine) (PubChem CID 158230796) has the molecular formula C48H81B3N8O8 and a molecular weight of 930.66 g/mol. Its IUPAC name is tert-butyl 4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazol-1-yl]cyclohexane-1-carboxylate;bis(4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazol-1-yl]piperidine).
| Compound Name | tert-butyl 4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazol-1-yl]cyclohexane-1-carboxylate;bis(4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazol-1-yl]piperidine) |
|---|---|
| PubChem CID | 158230796 |
| Molecular Formula | C48H81B3N8O8 |
| Molecular Weight | 930.66 g/mol |
| Exact Mass | 930.65 |
| IUPAC Name | tert-butyl 4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazol-1-yl]cyclohexane-1-carboxylate;bis(4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazol-1-yl]piperidine) |
| SMILES | CC(C)(C)OC(=O)C1CCC(n2cc(B3OC(C)(C)C(C)(C)O3)cn2)CC1.CC1(C)OB(c2cnn(C3CCNCC3)c2)OC1(C)C.CC1(C)OB(c2cnn(C3CCNCC3)c2)OC1(C)C |
| InChI | InChI=1S/C20H33BN2O4.2C14H24BN3O2/c1-18(2,3)25-17(24)14-8-10-16(11-9-14)23-13-15(12-22-23)21-26-19(4,5)20(6,7)27-21;2*1-13(2)14(3,4)20-15(19-13)11-9-17-18(10-11)12-5-7-16-8-6-12/h12-14,16H,8-11H2,1-7H3;2*9-10,12,16H,5-8H2,1-4H3 |
| InChIKey | GEIZENOENHQFBR-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 159.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 67 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 930.66 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|