C18H30BN3O4 — CID 68640398
tert-butyl 4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazol-1-yl]pyrrolidine-2-carboxylate (PubChem CID 68640398) has the molecular formula C18H30BN3O4 and a molecular weight of 363.27 g/mol. Its IUPAC name is tert-butyl 4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazol-1-yl]pyrrolidine-2-carboxylate.
| Compound Name | tert-butyl 4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazol-1-yl]pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 68640398 |
| Molecular Formula | C18H30BN3O4 |
| Molecular Weight | 363.27 g/mol |
| Exact Mass | 363.23 |
| IUPAC Name | tert-butyl 4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazol-1-yl]pyrrolidine-2-carboxylate |
| SMILES | CC(C)(C)OC(=O)C1CC(n2cc(B3OC(C)(C)C(C)(C)O3)cn2)CN1 |
| InChI | InChI=1S/C18H30BN3O4/c1-16(2,3)24-15(23)14-8-13(10-20-14)22-11-12(9-21-22)19-25-17(4,5)18(6,7)26-19/h9,11,13-14,20H,8,10H2,1-7H3 |
| InChIKey | XXHCDZMCLZRVCP-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 74.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.27 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|