C20H34BN3O5 — CID 142603809
tert-butyl (4R)-2,2-dimethyl-4-[[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazol-1-yl]methyl]-1,3-oxazolidine-3-carboxylate (PubChem CID 142603809) has the molecular formula C20H34BN3O5 and a molecular weight of 407.32 g/mol. Its IUPAC name is tert-butyl (4R)-2,2-dimethyl-4-[[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazol-1-yl]methyl]-1,3-oxazolidine-3-carboxylate.
| Compound Name | tert-butyl (4R)-2,2-dimethyl-4-[[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazol-1-yl]methyl]-1,3-oxazolidine-3-carboxylate |
|---|---|
| PubChem CID | 142603809 |
| Molecular Formula | C20H34BN3O5 |
| Molecular Weight | 407.32 g/mol |
| Exact Mass | 407.26 |
| IUPAC Name | tert-butyl (4R)-2,2-dimethyl-4-[[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazol-1-yl]methyl]-1,3-oxazolidine-3-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1[C@H](Cn2cc(B3OC(C)(C)C(C)(C)O3)cn2)COC1(C)C |
| InChI | InChI=1S/C20H34BN3O5/c1-17(2,3)27-16(25)24-15(13-26-20(24,8)9)12-23-11-14(10-22-23)21-28-18(4,5)19(6,7)29-21/h10-11,15H,12-13H2,1-9H3/t15-/m1/s1 |
| InChIKey | NZUUMYPYRIYCSK-OAHLLOKOSA-N |
| XLogP | 2.55 |
| TPSA | 75.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.32 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|