C19H33BN2O5 — CID 145261866
tert-butyl 2-[4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazol-1-yl]butoxy]acetate (PubChem CID 145261866) has the molecular formula C19H33BN2O5 and a molecular weight of 380.29 g/mol. Its IUPAC name is tert-butyl 2-[4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazol-1-yl]butoxy]acetate.
| Compound Name | tert-butyl 2-[4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazol-1-yl]butoxy]acetate |
|---|---|
| PubChem CID | 145261866 |
| Molecular Formula | C19H33BN2O5 |
| Molecular Weight | 380.29 g/mol |
| Exact Mass | 380.25 |
| IUPAC Name | tert-butyl 2-[4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazol-1-yl]butoxy]acetate |
| SMILES | CC(C)(C)OC(=O)COCCCCn1cc(B2OC(C)(C)C(C)(C)O2)cn1 |
| InChI | InChI=1S/C19H33BN2O5/c1-17(2,3)25-16(23)14-24-11-9-8-10-22-13-15(12-21-22)20-26-18(4,5)19(6,7)27-20/h12-13H,8-11,14H2,1-7H3 |
| InChIKey | FJZPEPDIOCSQEW-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 71.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.29 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|