C22H38BN3O4 — CID 142458156
tert-butyl (2S,6R)-2,6-dimethyl-4-[[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazol-1-yl]methyl]piperidine-1-carboxylate (PubChem CID 142458156) has the molecular formula C22H38BN3O4 and a molecular weight of 419.38 g/mol. Its IUPAC name is tert-butyl (2S,6R)-2,6-dimethyl-4-[[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazol-1-yl]methyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl (2S,6R)-2,6-dimethyl-4-[[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazol-1-yl]methyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 142458156 |
| Molecular Formula | C22H38BN3O4 |
| Molecular Weight | 419.38 g/mol |
| Exact Mass | 419.30 |
| IUPAC Name | tert-butyl (2S,6R)-2,6-dimethyl-4-[[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazol-1-yl]methyl]piperidine-1-carboxylate |
| SMILES | C[C@@H]1CC(Cn2cc(B3OC(C)(C)C(C)(C)O3)cn2)C[C@H](C)N1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C22H38BN3O4/c1-15-10-17(11-16(2)26(15)19(27)28-20(3,4)5)13-25-14-18(12-24-25)23-29-21(6,7)22(8,9)30-23/h12,14-17H,10-11,13H2,1-9H3/t15-,16+,17? |
| InChIKey | MLUQQDWQJHPJDM-SJPCQFCGSA-N |
| XLogP | 3.61 |
| TPSA | 65.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.38 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|