C13H22BN3O4 — CID 174087001
tert-butyl 4-(4-amino-4,5,5-trimethyl-1,3,2-dioxaborolan-2-yl)pyrazole-1-carboxylate (PubChem CID 174087001) has the molecular formula C13H22BN3O4 and a molecular weight of 295.15 g/mol. Its IUPAC name is tert-butyl 4-(4-amino-4,5,5-trimethyl-1,3,2-dioxaborolan-2-yl)pyrazole-1-carboxylate.
| Compound Name | tert-butyl 4-(4-amino-4,5,5-trimethyl-1,3,2-dioxaborolan-2-yl)pyrazole-1-carboxylate |
|---|---|
| PubChem CID | 174087001 |
| Molecular Formula | C13H22BN3O4 |
| Molecular Weight | 295.15 g/mol |
| Exact Mass | 295.17 |
| IUPAC Name | tert-butyl 4-(4-amino-4,5,5-trimethyl-1,3,2-dioxaborolan-2-yl)pyrazole-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)n1cc(B2OC(C)(C)C(C)(N)O2)cn1 |
| InChI | InChI=1S/C13H22BN3O4/c1-11(2,3)19-10(18)17-8-9(7-16-17)14-20-12(4,5)13(6,15)21-14/h7-8H,15H2,1-6H3 |
| InChIKey | FKNACMFSCISGRV-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 88.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.15 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|