C14H23BN2O4 — CID 140618184
tert-butyl 4-(4,4,5,5-tetramethyldioxaborolan-3-yl)pyrazole-1-carboxylate (PubChem CID 140618184) has the molecular formula C14H23BN2O4 and a molecular weight of 294.16 g/mol. Its IUPAC name is tert-butyl 4-(4,4,5,5-tetramethyldioxaborolan-3-yl)pyrazole-1-carboxylate.
| Compound Name | tert-butyl 4-(4,4,5,5-tetramethyldioxaborolan-3-yl)pyrazole-1-carboxylate |
|---|---|
| PubChem CID | 140618184 |
| Molecular Formula | C14H23BN2O4 |
| Molecular Weight | 294.16 g/mol |
| Exact Mass | 294.18 |
| IUPAC Name | tert-butyl 4-(4,4,5,5-tetramethyldioxaborolan-3-yl)pyrazole-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)n1cc(B2OOC(C)(C)C2(C)C)cn1 |
| InChI | InChI=1S/C14H23BN2O4/c1-12(2,3)19-11(18)17-9-10(8-16-17)15-13(4,5)14(6,7)20-21-15/h8-9H,1-7H3 |
| InChIKey | DSHHAOQEDQVCQT-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 62.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.16 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|