C9H14N4O2S — CID 134821945
tert-butyl 4-(carbamothioylamino)pyrazole-1-carboxylate (PubChem CID 134821945) has the molecular formula C9H14N4O2S and a molecular weight of 242.30 g/mol. Its IUPAC name is tert-butyl 4-(carbamothioylamino)pyrazole-1-carboxylate.
| Compound Name | tert-butyl 4-(carbamothioylamino)pyrazole-1-carboxylate |
|---|---|
| PubChem CID | 134821945 |
| Molecular Formula | C9H14N4O2S |
| Molecular Weight | 242.30 g/mol |
| Exact Mass | 242.08 |
| IUPAC Name | tert-butyl 4-(carbamothioylamino)pyrazole-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)n1cc(NC(N)=S)cn1 |
| InChI | InChI=1S/C9H14N4O2S/c1-9(2,3)15-8(14)13-5-6(4-11-13)12-7(10)16/h4-5H,1-3H3,(H3,10,12,16) |
| InChIKey | YWSDTIRIXUIUNP-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 82.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.30 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|