C10H16N4O3 — CID 65143031
tert-butyl N-[1-(2-amino-2-oxoethyl)pyrazol-4-yl]carbamate (PubChem CID 65143031) has the molecular formula C10H16N4O3 and a molecular weight of 240.26 g/mol. Its IUPAC name is tert-butyl N-[1-(2-amino-2-oxoethyl)pyrazol-4-yl]carbamate.
| Compound Name | tert-butyl N-[1-(2-amino-2-oxoethyl)pyrazol-4-yl]carbamate |
|---|---|
| PubChem CID | 65143031 |
| Molecular Formula | C10H16N4O3 |
| Molecular Weight | 240.26 g/mol |
| Exact Mass | 240.12 |
| IUPAC Name | tert-butyl N-[1-(2-amino-2-oxoethyl)pyrazol-4-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1cnn(CC(N)=O)c1 |
| InChI | InChI=1S/C10H16N4O3/c1-10(2,3)17-9(16)13-7-4-12-14(5-7)6-8(11)15/h4-5H,6H2,1-3H3,(H2,11,15)(H,13,16) |
| InChIKey | DZLCUURKQNNFJQ-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 99.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.26 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |