C19H23N7O3 — CID 90389743
tert-butyl 4-[[5-amino-4-(4-methoxyanilino)pyrimidin-2-yl]amino]pyrazole-1-carboxylate (PubChem CID 90389743) has the molecular formula C19H23N7O3 and a molecular weight of 397.44 g/mol. Its IUPAC name is tert-butyl 4-[[5-amino-4-(4-methoxyanilino)pyrimidin-2-yl]amino]pyrazole-1-carboxylate.
| Compound Name | tert-butyl 4-[[5-amino-4-(4-methoxyanilino)pyrimidin-2-yl]amino]pyrazole-1-carboxylate |
|---|---|
| PubChem CID | 90389743 |
| Molecular Formula | C19H23N7O3 |
| Molecular Weight | 397.44 g/mol |
| Exact Mass | 397.19 |
| IUPAC Name | tert-butyl 4-[[5-amino-4-(4-methoxyanilino)pyrimidin-2-yl]amino]pyrazole-1-carboxylate |
| SMILES | COc1ccc(Nc2nc(Nc3cnn(C(=O)OC(C)(C)C)c3)ncc2N)cc1 |
| InChI | InChI=1S/C19H23N7O3/c1-19(2,3)29-18(27)26-11-13(9-22-26)24-17-21-10-15(20)16(25-17)23-12-5-7-14(28-4)8-6-12/h5-11H,20H2,1-4H3,(H2,21,23,24,25) |
| InChIKey | CSCFYUJFANMLOO-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 129.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.44 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |