C22H26N6O3 — CID 174817692
[4-[[5-amino-2-(4-methoxyanilino)pyrimidin-4-yl]amino]phenyl] N-tert-butylcarbamate (PubChem CID 174817692) has the molecular formula C22H26N6O3 and a molecular weight of 422.49 g/mol. Its IUPAC name is [4-[[5-amino-2-(4-methoxyanilino)pyrimidin-4-yl]amino]phenyl] N-tert-butylcarbamate.
| Compound Name | [4-[[5-amino-2-(4-methoxyanilino)pyrimidin-4-yl]amino]phenyl] N-tert-butylcarbamate |
|---|---|
| PubChem CID | 174817692 |
| Molecular Formula | C22H26N6O3 |
| Molecular Weight | 422.49 g/mol |
| Exact Mass | 422.21 |
| IUPAC Name | [4-[[5-amino-2-(4-methoxyanilino)pyrimidin-4-yl]amino]phenyl] N-tert-butylcarbamate |
| SMILES | COc1ccc(Nc2ncc(N)c(Nc3ccc(OC(=O)NC(C)(C)C)cc3)n2)cc1 |
| InChI | InChI=1S/C22H26N6O3/c1-22(2,3)28-21(29)31-17-11-7-14(8-12-17)25-19-18(23)13-24-20(27-19)26-15-5-9-16(30-4)10-6-15/h5-13H,23H2,1-4H3,(H,28,29)(H2,24,25,26,27) |
| InChIKey | VLSYLPNOMDKIMT-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 123.42 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.49 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |