C18H26ClN5O2 — CID 144742959
tert-butyl N-[[4-[(5-amino-2-chloropyrimidin-4-yl)amino]phenyl]methyl]carbamate;ethane (PubChem CID 144742959) has the molecular formula C18H26ClN5O2 and a molecular weight of 379.89 g/mol. Its IUPAC name is tert-butyl N-[[4-[(5-amino-2-chloropyrimidin-4-yl)amino]phenyl]methyl]carbamate;ethane.
| Compound Name | tert-butyl N-[[4-[(5-amino-2-chloropyrimidin-4-yl)amino]phenyl]methyl]carbamate;ethane |
|---|---|
| PubChem CID | 144742959 |
| Molecular Formula | C18H26ClN5O2 |
| Molecular Weight | 379.89 g/mol |
| Exact Mass | 379.18 |
| IUPAC Name | tert-butyl N-[[4-[(5-amino-2-chloropyrimidin-4-yl)amino]phenyl]methyl]carbamate;ethane |
| SMILES | CC.CC(C)(C)OC(=O)NCc1ccc(Nc2nc(Cl)ncc2N)cc1 |
| InChI | InChI=1S/C16H20ClN5O2.C2H6/c1-16(2,3)24-15(23)20-8-10-4-6-11(7-5-10)21-13-12(18)9-19-14(17)22-13;1-2/h4-7,9H,8,18H2,1-3H3,(H,20,23)(H,19,21,22);1-2H3 |
| InChIKey | OGLRXAGQWOAIDB-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 102.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.89 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |