C14H15ClN4O3 — CID 123847132
4-[4-[(5-amino-2-chloropyrimidin-4-yl)amino]phenoxy]butanoic acid (PubChem CID 123847132) has the molecular formula C14H15ClN4O3 and a molecular weight of 322.75 g/mol. Its IUPAC name is 4-[4-[(5-amino-2-chloropyrimidin-4-yl)amino]phenoxy]butanoic acid.
| Compound Name | 4-[4-[(5-amino-2-chloropyrimidin-4-yl)amino]phenoxy]butanoic acid |
|---|---|
| PubChem CID | 123847132 |
| Molecular Formula | C14H15ClN4O3 |
| Molecular Weight | 322.75 g/mol |
| Exact Mass | 322.08 |
| IUPAC Name | 4-[4-[(5-amino-2-chloropyrimidin-4-yl)amino]phenoxy]butanoic acid |
| SMILES | Nc1cnc(Cl)nc1Nc1ccc(OCCCC(=O)O)cc1 |
| InChI | InChI=1S/C14H15ClN4O3/c15-14-17-8-11(16)13(19-14)18-9-3-5-10(6-4-9)22-7-1-2-12(20)21/h3-6,8H,1-2,7,16H2,(H,20,21)(H,17,18,19) |
| InChIKey | IYVRFKYTOAYFFS-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 110.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.75 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|