C28H27Cl3N8O10 — CID 162140830
2,4-dichloro-5-nitropyrimidine;methyl 3-(4-aminophenoxy)propanoate;methyl 3-[4-[(2-chloro-5-nitropyrimidin-4-yl)amino]phenoxy]propanoate (PubChem CID 162140830) has the molecular formula C28H27Cl3N8O10 and a molecular weight of 741.93 g/mol. Its IUPAC name is 2,4-dichloro-5-nitropyrimidine;methyl 3-(4-aminophenoxy)propanoate;methyl 3-[4-[(2-chloro-5-nitropyrimidin-4-yl)amino]phenoxy]propanoate.
| Compound Name | 2,4-dichloro-5-nitropyrimidine;methyl 3-(4-aminophenoxy)propanoate;methyl 3-[4-[(2-chloro-5-nitropyrimidin-4-yl)amino]phenoxy]propanoate |
|---|---|
| PubChem CID | 162140830 |
| Molecular Formula | C28H27Cl3N8O10 |
| Molecular Weight | 741.93 g/mol |
| Exact Mass | 740.09 |
| IUPAC Name | 2,4-dichloro-5-nitropyrimidine;methyl 3-(4-aminophenoxy)propanoate;methyl 3-[4-[(2-chloro-5-nitropyrimidin-4-yl)amino]phenoxy]propanoate |
| SMILES | COC(=O)CCOc1ccc(N)cc1.COC(=O)CCOc1ccc(Nc2nc(Cl)ncc2[N+](=O)[O-])cc1.O=[N+]([O-])c1cnc(Cl)nc1Cl |
| InChI | InChI=1S/C14H13ClN4O5.C10H13NO3.C4HCl2N3O2/c1-23-12(20)6-7-24-10-4-2-9(3-5-10)17-13-11(19(21)22)8-16-14(15)18-13;1-13-10(12)6-7-14-9-4-2-8(11)3-5-9;5-3-2(9(10)11)1-7-4(6)8-3/h2-5,8H,6-7H2,1H3,(H,16,17,18);2-5H,6-7,11H2,1H3;1H |
| InChIKey | ZJXCXAOLQJSNPP-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 246.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 49 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 741.93 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|