C9H12ClN5O3 — CID 106279542
3-[(2-chloro-5-nitropyrimidin-4-yl)amino]-2,2-dimethylpropanamide (PubChem CID 106279542) has the molecular formula C9H12ClN5O3 and a molecular weight of 273.68 g/mol. Its IUPAC name is 3-[(2-chloro-5-nitropyrimidin-4-yl)amino]-2,2-dimethylpropanamide.
| Compound Name | 3-[(2-chloro-5-nitropyrimidin-4-yl)amino]-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 106279542 |
| Molecular Formula | C9H12ClN5O3 |
| Molecular Weight | 273.68 g/mol |
| Exact Mass | 273.06 |
| IUPAC Name | 3-[(2-chloro-5-nitropyrimidin-4-yl)amino]-2,2-dimethylpropanamide |
| SMILES | CC(C)(CNc1nc(Cl)ncc1[N+](=O)[O-])C(N)=O |
| InChI | InChI=1S/C9H12ClN5O3/c1-9(2,7(11)16)4-13-6-5(15(17)18)3-12-8(10)14-6/h3H,4H2,1-2H3,(H2,11,16)(H,12,13,14) |
| InChIKey | VXAKOGNFOCUQOX-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 124.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.68 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|