C9H10ClN7O2 — CID 106303932
2-chloro-N-[(4-ethyl-1,2,4-triazol-3-yl)methyl]-5-nitropyrimidin-4-amine (PubChem CID 106303932) has the molecular formula C9H10ClN7O2 and a molecular weight of 283.68 g/mol. Its IUPAC name is 2-chloro-N-[(4-ethyl-1,2,4-triazol-3-yl)methyl]-5-nitropyrimidin-4-amine.
| Compound Name | 2-chloro-N-[(4-ethyl-1,2,4-triazol-3-yl)methyl]-5-nitropyrimidin-4-amine |
|---|---|
| PubChem CID | 106303932 |
| Molecular Formula | C9H10ClN7O2 |
| Molecular Weight | 283.68 g/mol |
| Exact Mass | 283.06 |
| IUPAC Name | 2-chloro-N-[(4-ethyl-1,2,4-triazol-3-yl)methyl]-5-nitropyrimidin-4-amine |
| SMILES | CCn1cnnc1CNc1nc(Cl)ncc1[N+](=O)[O-] |
| InChI | InChI=1S/C9H10ClN7O2/c1-2-16-5-13-15-7(16)4-11-8-6(17(18)19)3-12-9(10)14-8/h3,5H,2,4H2,1H3,(H,11,12,14) |
| InChIKey | FCSSJPSLEFSFOH-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 111.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.68 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|