C10H11ClN6O2 — CID 106303917
6-chloro-N-[(4-ethyl-1,2,4-triazol-3-yl)methyl]-3-nitropyridin-2-amine (PubChem CID 106303917) has the molecular formula C10H11ClN6O2 and a molecular weight of 282.69 g/mol. Its IUPAC name is 6-chloro-N-[(4-ethyl-1,2,4-triazol-3-yl)methyl]-3-nitropyridin-2-amine.
| Compound Name | 6-chloro-N-[(4-ethyl-1,2,4-triazol-3-yl)methyl]-3-nitropyridin-2-amine |
|---|---|
| PubChem CID | 106303917 |
| Molecular Formula | C10H11ClN6O2 |
| Molecular Weight | 282.69 g/mol |
| Exact Mass | 282.06 |
| IUPAC Name | 6-chloro-N-[(4-ethyl-1,2,4-triazol-3-yl)methyl]-3-nitropyridin-2-amine |
| SMILES | CCn1cnnc1CNc1nc(Cl)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C10H11ClN6O2/c1-2-16-6-13-15-9(16)5-12-10-7(17(18)19)3-4-8(11)14-10/h3-4,6H,2,5H2,1H3,(H,12,14) |
| InChIKey | WHWWOHCFDBFLFU-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 98.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.69 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|