C11H11ClFN5O2 — CID 106303361
5-chloro-N-[(4-ethyl-1,2,4-triazol-3-yl)methyl]-4-fluoro-2-nitroaniline (PubChem CID 106303361) has the molecular formula C11H11ClFN5O2 and a molecular weight of 299.69 g/mol. Its IUPAC name is 5-chloro-N-[(4-ethyl-1,2,4-triazol-3-yl)methyl]-4-fluoro-2-nitroaniline.
| Compound Name | 5-chloro-N-[(4-ethyl-1,2,4-triazol-3-yl)methyl]-4-fluoro-2-nitroaniline |
|---|---|
| PubChem CID | 106303361 |
| Molecular Formula | C11H11ClFN5O2 |
| Molecular Weight | 299.69 g/mol |
| Exact Mass | 299.06 |
| IUPAC Name | 5-chloro-N-[(4-ethyl-1,2,4-triazol-3-yl)methyl]-4-fluoro-2-nitroaniline |
| SMILES | CCn1cnnc1CNc1cc(Cl)c(F)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C11H11ClFN5O2/c1-2-17-6-15-16-11(17)5-14-9-3-7(12)8(13)4-10(9)18(19)20/h3-4,6,14H,2,5H2,1H3 |
| InChIKey | PXSOLIPFKDWRBC-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 85.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.69 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|