C10H13ClFN3O2 — CID 113282802
1-N-(4-chloro-5-fluoro-2-nitrophenyl)-2-methylpropane-1,2-diamine (PubChem CID 113282802) has the molecular formula C10H13ClFN3O2 and a molecular weight of 261.68 g/mol. Its IUPAC name is 1-N-(4-chloro-5-fluoro-2-nitrophenyl)-2-methylpropane-1,2-diamine.
| Compound Name | 1-N-(4-chloro-5-fluoro-2-nitrophenyl)-2-methylpropane-1,2-diamine |
|---|---|
| PubChem CID | 113282802 |
| Molecular Formula | C10H13ClFN3O2 |
| Molecular Weight | 261.68 g/mol |
| Exact Mass | 261.07 |
| IUPAC Name | 1-N-(4-chloro-5-fluoro-2-nitrophenyl)-2-methylpropane-1,2-diamine |
| SMILES | CC(C)(N)CNc1cc(F)c(Cl)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C10H13ClFN3O2/c1-10(2,13)5-14-8-4-7(12)6(11)3-9(8)15(16)17/h3-4,14H,5,13H2,1-2H3 |
| InChIKey | BQIDXCFVAIAIIS-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 81.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.68 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|