C10H10ClFN2O4 — CID 66077361
3-(4-chloro-5-fluoro-2-nitroanilino)-2-methylpropanoic acid (PubChem CID 66077361) has the molecular formula C10H10ClFN2O4 and a molecular weight of 276.65 g/mol. Its IUPAC name is 3-(4-chloro-5-fluoro-2-nitroanilino)-2-methylpropanoic acid.
| Compound Name | 3-(4-chloro-5-fluoro-2-nitroanilino)-2-methylpropanoic acid |
|---|---|
| PubChem CID | 66077361 |
| Molecular Formula | C10H10ClFN2O4 |
| Molecular Weight | 276.65 g/mol |
| Exact Mass | 276.03 |
| IUPAC Name | 3-(4-chloro-5-fluoro-2-nitroanilino)-2-methylpropanoic acid |
| SMILES | CC(CNc1cc(F)c(Cl)cc1[N+](=O)[O-])C(=O)O |
| InChI | InChI=1S/C10H10ClFN2O4/c1-5(10(15)16)4-13-8-3-7(12)6(11)2-9(8)14(17)18/h2-3,5,13H,4H2,1H3,(H,15,16) |
| InChIKey | BJPDIVJTGUDPMA-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 92.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.65 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|