C9H9ClN6O2 — CID 55037654
6-chloro-N-[(4-methyl-1,2,4-triazol-3-yl)methyl]-3-nitropyridin-2-amine (PubChem CID 55037654) has the molecular formula C9H9ClN6O2 and a molecular weight of 268.66 g/mol. Its IUPAC name is 6-chloro-N-[(4-methyl-1,2,4-triazol-3-yl)methyl]-3-nitropyridin-2-amine.
| Compound Name | 6-chloro-N-[(4-methyl-1,2,4-triazol-3-yl)methyl]-3-nitropyridin-2-amine |
|---|---|
| PubChem CID | 55037654 |
| Molecular Formula | C9H9ClN6O2 |
| Molecular Weight | 268.66 g/mol |
| Exact Mass | 268.05 |
| IUPAC Name | 6-chloro-N-[(4-methyl-1,2,4-triazol-3-yl)methyl]-3-nitropyridin-2-amine |
| SMILES | Cn1cnnc1CNc1nc(Cl)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C9H9ClN6O2/c1-15-5-12-14-8(15)4-11-9-6(16(17)18)2-3-7(10)13-9/h2-3,5H,4H2,1H3,(H,11,13) |
| InChIKey | JUYNMFYTEQNEFK-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 98.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.66 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|