C10H10ClN5O4S — CID 61047273
4-chloro-N-[(4-methyl-1,2,4-triazol-3-yl)methyl]-3-nitrobenzenesulfonamide (PubChem CID 61047273) has the molecular formula C10H10ClN5O4S and a molecular weight of 331.74 g/mol. Its IUPAC name is 4-chloro-N-[(4-methyl-1,2,4-triazol-3-yl)methyl]-3-nitrobenzenesulfonamide.
| Compound Name | 4-chloro-N-[(4-methyl-1,2,4-triazol-3-yl)methyl]-3-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 61047273 |
| Molecular Formula | C10H10ClN5O4S |
| Molecular Weight | 331.74 g/mol |
| Exact Mass | 331.01 |
| IUPAC Name | 4-chloro-N-[(4-methyl-1,2,4-triazol-3-yl)methyl]-3-nitrobenzenesulfonamide |
| SMILES | Cn1cnnc1CNS(=O)(=O)c1ccc(Cl)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C10H10ClN5O4S/c1-15-6-12-14-10(15)5-13-21(19,20)7-2-3-8(11)9(4-7)16(17)18/h2-4,6,13H,5H2,1H3 |
| InChIKey | YOTBZYASDAXHSV-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 120.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.74 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|