C9H13N7O2S — CID 55037929
2-hydrazinyl-N-[(4-methyl-1,2,4-triazol-3-yl)methyl]pyridine-4-sulfonamide (PubChem CID 55037929) has the molecular formula C9H13N7O2S and a molecular weight of 283.32 g/mol. Its IUPAC name is 2-hydrazinyl-N-[(4-methyl-1,2,4-triazol-3-yl)methyl]pyridine-4-sulfonamide.
| Compound Name | 2-hydrazinyl-N-[(4-methyl-1,2,4-triazol-3-yl)methyl]pyridine-4-sulfonamide |
|---|---|
| PubChem CID | 55037929 |
| Molecular Formula | C9H13N7O2S |
| Molecular Weight | 283.32 g/mol |
| Exact Mass | 283.09 |
| IUPAC Name | 2-hydrazinyl-N-[(4-methyl-1,2,4-triazol-3-yl)methyl]pyridine-4-sulfonamide |
| SMILES | Cn1cnnc1CNS(=O)(=O)c1ccnc(NN)c1 |
| InChI | InChI=1S/C9H13N7O2S/c1-16-6-12-15-9(16)5-13-19(17,18)7-2-3-11-8(4-7)14-10/h2-4,6,13H,5,10H2,1H3,(H,11,14) |
| InChIKey | PHRGAEMNBAVMKQ-UHFFFAOYSA-N |
| XLogP | -1.03 |
| TPSA | 127.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.32 |
| LogP ≤ 5 | -1.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|