C7H9F3N4O2S — CID 61004239
2-hydrazinyl-N-(2,2,2-trifluoroethyl)pyridine-4-sulfonamide (PubChem CID 61004239) has the molecular formula C7H9F3N4O2S and a molecular weight of 270.24 g/mol. Its IUPAC name is 2-hydrazinyl-N-(2,2,2-trifluoroethyl)pyridine-4-sulfonamide.
| Compound Name | 2-hydrazinyl-N-(2,2,2-trifluoroethyl)pyridine-4-sulfonamide |
|---|---|
| PubChem CID | 61004239 |
| Molecular Formula | C7H9F3N4O2S |
| Molecular Weight | 270.24 g/mol |
| Exact Mass | 270.04 |
| IUPAC Name | 2-hydrazinyl-N-(2,2,2-trifluoroethyl)pyridine-4-sulfonamide |
| SMILES | NNc1cc(S(=O)(=O)NCC(F)(F)F)ccn1 |
| InChI | InChI=1S/C7H9F3N4O2S/c8-7(9,10)4-13-17(15,16)5-1-2-12-6(3-5)14-11/h1-3,13H,4,11H2,(H,12,14) |
| InChIKey | GDOJRHBDISCGTN-UHFFFAOYSA-N |
| XLogP | 0.21 |
| TPSA | 97.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.24 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|