C9H12N6O3S — CID 106401561
2-hydrazinyl-N-[2-(1,2,4-oxadiazol-5-yl)ethyl]pyridine-4-sulfonamide (PubChem CID 106401561) has the molecular formula C9H12N6O3S and a molecular weight of 284.30 g/mol. Its IUPAC name is 2-hydrazinyl-N-[2-(1,2,4-oxadiazol-5-yl)ethyl]pyridine-4-sulfonamide.
| Compound Name | 2-hydrazinyl-N-[2-(1,2,4-oxadiazol-5-yl)ethyl]pyridine-4-sulfonamide |
|---|---|
| PubChem CID | 106401561 |
| Molecular Formula | C9H12N6O3S |
| Molecular Weight | 284.30 g/mol |
| Exact Mass | 284.07 |
| IUPAC Name | 2-hydrazinyl-N-[2-(1,2,4-oxadiazol-5-yl)ethyl]pyridine-4-sulfonamide |
| SMILES | NNc1cc(S(=O)(=O)NCCc2ncno2)ccn1 |
| InChI | InChI=1S/C9H12N6O3S/c10-15-8-5-7(1-3-11-8)19(16,17)14-4-2-9-12-6-13-18-9/h1,3,5-6,14H,2,4,10H2,(H,11,15) |
| InChIKey | FQCJPNZXEHKELZ-UHFFFAOYSA-N |
| XLogP | -0.73 |
| TPSA | 136.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.30 |
| LogP ≤ 5 | -0.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|