C13H15N3O4S — CID 103823879
N-[2-(1,2,4-oxadiazol-5-yl)ethyl]-3-propanoylbenzenesulfonamide (PubChem CID 103823879) has the molecular formula C13H15N3O4S and a molecular weight of 309.35 g/mol. Its IUPAC name is N-[2-(1,2,4-oxadiazol-5-yl)ethyl]-3-propanoylbenzenesulfonamide.
| Compound Name | N-[2-(1,2,4-oxadiazol-5-yl)ethyl]-3-propanoylbenzenesulfonamide |
|---|---|
| PubChem CID | 103823879 |
| Molecular Formula | C13H15N3O4S |
| Molecular Weight | 309.35 g/mol |
| Exact Mass | 309.08 |
| IUPAC Name | N-[2-(1,2,4-oxadiazol-5-yl)ethyl]-3-propanoylbenzenesulfonamide |
| SMILES | CCC(=O)c1cccc(S(=O)(=O)NCCc2ncno2)c1 |
| InChI | InChI=1S/C13H15N3O4S/c1-2-12(17)10-4-3-5-11(8-10)21(18,19)16-7-6-13-14-9-15-20-13/h3-5,8-9,16H,2,6-7H2,1H3 |
| InChIKey | MUXSWMGZAGPENY-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 102.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.35 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |