C12H18N2O5S2 — CID 102675948
N-[2-(methylsulfamoyl)ethyl]-3-propanoylbenzenesulfonamide (PubChem CID 102675948) has the molecular formula C12H18N2O5S2 and a molecular weight of 334.42 g/mol. Its IUPAC name is N-[2-(methylsulfamoyl)ethyl]-3-propanoylbenzenesulfonamide.
| Compound Name | N-[2-(methylsulfamoyl)ethyl]-3-propanoylbenzenesulfonamide |
|---|---|
| PubChem CID | 102675948 |
| Molecular Formula | C12H18N2O5S2 |
| Molecular Weight | 334.42 g/mol |
| Exact Mass | 334.07 |
| IUPAC Name | N-[2-(methylsulfamoyl)ethyl]-3-propanoylbenzenesulfonamide |
| SMILES | CCC(=O)c1cccc(S(=O)(=O)NCCS(=O)(=O)NC)c1 |
| InChI | InChI=1S/C12H18N2O5S2/c1-3-12(15)10-5-4-6-11(9-10)21(18,19)14-7-8-20(16,17)13-2/h4-6,9,13-14H,3,7-8H2,1-2H3 |
| InChIKey | RGAQBOLNUYETSO-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 109.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.42 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |