C12H14F3NO3S2 — CID 103823487
3-propanoyl-N-[2-(trifluoromethylsulfanyl)ethyl]benzenesulfonamide (PubChem CID 103823487) has the molecular formula C12H14F3NO3S2 and a molecular weight of 341.38 g/mol. Its IUPAC name is 3-propanoyl-N-[2-(trifluoromethylsulfanyl)ethyl]benzenesulfonamide.
| Compound Name | 3-propanoyl-N-[2-(trifluoromethylsulfanyl)ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 103823487 |
| Molecular Formula | C12H14F3NO3S2 |
| Molecular Weight | 341.38 g/mol |
| Exact Mass | 341.04 |
| IUPAC Name | 3-propanoyl-N-[2-(trifluoromethylsulfanyl)ethyl]benzenesulfonamide |
| SMILES | CCC(=O)c1cccc(S(=O)(=O)NCCSC(F)(F)F)c1 |
| InChI | InChI=1S/C12H14F3NO3S2/c1-2-11(17)9-4-3-5-10(8-9)21(18,19)16-6-7-20-12(13,14)15/h3-5,8,16H,2,6-7H2,1H3 |
| InChIKey | UOQYMOZXGJSXBZ-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.38 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|