C10H11N5O5S — CID 106407950
3-amino-4-nitro-N-[2-(1,2,4-oxadiazol-5-yl)ethyl]benzenesulfonamide (PubChem CID 106407950) has the molecular formula C10H11N5O5S and a molecular weight of 313.30 g/mol. Its IUPAC name is 3-amino-4-nitro-N-[2-(1,2,4-oxadiazol-5-yl)ethyl]benzenesulfonamide.
| Compound Name | 3-amino-4-nitro-N-[2-(1,2,4-oxadiazol-5-yl)ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 106407950 |
| Molecular Formula | C10H11N5O5S |
| Molecular Weight | 313.30 g/mol |
| Exact Mass | 313.05 |
| IUPAC Name | 3-amino-4-nitro-N-[2-(1,2,4-oxadiazol-5-yl)ethyl]benzenesulfonamide |
| SMILES | Nc1cc(S(=O)(=O)NCCc2ncno2)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C10H11N5O5S/c11-8-5-7(1-2-9(8)15(16)17)21(18,19)14-4-3-10-12-6-13-20-10/h1-2,5-6,14H,3-4,11H2 |
| InChIKey | MUCRYZBUPXVOFM-UHFFFAOYSA-N |
| XLogP | 0.08 |
| TPSA | 154.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.30 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|