C9H10ClN5O2S — CID 35387073
6-chloro-N-[(4-methyl-1,2,4-triazol-3-yl)methyl]pyridine-3-sulfonamide (PubChem CID 35387073) has the molecular formula C9H10ClN5O2S and a molecular weight of 287.73 g/mol. Its IUPAC name is 6-chloro-N-[(4-methyl-1,2,4-triazol-3-yl)methyl]pyridine-3-sulfonamide.
| Compound Name | 6-chloro-N-[(4-methyl-1,2,4-triazol-3-yl)methyl]pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 35387073 |
| Molecular Formula | C9H10ClN5O2S |
| Molecular Weight | 287.73 g/mol |
| Exact Mass | 287.02 |
| IUPAC Name | 6-chloro-N-[(4-methyl-1,2,4-triazol-3-yl)methyl]pyridine-3-sulfonamide |
| SMILES | Cn1cnnc1CNS(=O)(=O)c1ccc(Cl)nc1 |
| InChI | InChI=1S/C9H10ClN5O2S/c1-15-6-12-14-9(15)5-13-18(16,17)7-2-3-8(10)11-4-7/h2-4,6,13H,5H2,1H3 |
| InChIKey | DIBTYSGLHXEZID-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 89.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.73 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|