C10H8ClN3O5S — CID 81170213
4-chloro-3-nitro-N-(1,2-oxazol-3-ylmethyl)benzenesulfonamide (PubChem CID 81170213) has the molecular formula C10H8ClN3O5S and a molecular weight of 317.71 g/mol. Its IUPAC name is 4-chloro-3-nitro-N-(1,2-oxazol-3-ylmethyl)benzenesulfonamide.
| Compound Name | 4-chloro-3-nitro-N-(1,2-oxazol-3-ylmethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 81170213 |
| Molecular Formula | C10H8ClN3O5S |
| Molecular Weight | 317.71 g/mol |
| Exact Mass | 316.99 |
| IUPAC Name | 4-chloro-3-nitro-N-(1,2-oxazol-3-ylmethyl)benzenesulfonamide |
| SMILES | O=[N+]([O-])c1cc(S(=O)(=O)NCc2ccon2)ccc1Cl |
| InChI | InChI=1S/C10H8ClN3O5S/c11-9-2-1-8(5-10(9)14(15)16)20(17,18)12-6-7-3-4-19-13-7/h1-5,12H,6H2 |
| InChIKey | ZOKNMCVSDNCINV-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 115.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.71 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|