C9H10ClN5O3S — CID 81177707
5-chloro-6-hydrazinyl-N-(1,2-oxazol-3-ylmethyl)pyridine-3-sulfonamide (PubChem CID 81177707) has the molecular formula C9H10ClN5O3S and a molecular weight of 303.73 g/mol. Its IUPAC name is 5-chloro-6-hydrazinyl-N-(1,2-oxazol-3-ylmethyl)pyridine-3-sulfonamide.
| Compound Name | 5-chloro-6-hydrazinyl-N-(1,2-oxazol-3-ylmethyl)pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 81177707 |
| Molecular Formula | C9H10ClN5O3S |
| Molecular Weight | 303.73 g/mol |
| Exact Mass | 303.02 |
| IUPAC Name | 5-chloro-6-hydrazinyl-N-(1,2-oxazol-3-ylmethyl)pyridine-3-sulfonamide |
| SMILES | NNc1ncc(S(=O)(=O)NCc2ccon2)cc1Cl |
| InChI | InChI=1S/C9H10ClN5O3S/c10-8-3-7(5-12-9(8)14-11)19(16,17)13-4-6-1-2-18-15-6/h1-3,5,13H,4,11H2,(H,12,14) |
| InChIKey | WCCDQXTVQHFRPG-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 123.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.73 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|