C9H11ClN6O2S — CID 64607994
5-chloro-6-hydrazinyl-N-(1H-pyrazol-4-ylmethyl)pyridine-3-sulfonamide (PubChem CID 64607994) has the molecular formula C9H11ClN6O2S and a molecular weight of 302.75 g/mol. Its IUPAC name is 5-chloro-6-hydrazinyl-N-(1H-pyrazol-4-ylmethyl)pyridine-3-sulfonamide.
| Compound Name | 5-chloro-6-hydrazinyl-N-(1H-pyrazol-4-ylmethyl)pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 64607994 |
| Molecular Formula | C9H11ClN6O2S |
| Molecular Weight | 302.75 g/mol |
| Exact Mass | 302.04 |
| IUPAC Name | 5-chloro-6-hydrazinyl-N-(1H-pyrazol-4-ylmethyl)pyridine-3-sulfonamide |
| SMILES | NNc1ncc(S(=O)(=O)NCc2cn[nH]c2)cc1Cl |
| InChI | InChI=1S/C9H11ClN6O2S/c10-8-1-7(5-12-9(8)16-11)19(17,18)15-4-6-2-13-14-3-6/h1-3,5,15H,4,11H2,(H,12,16)(H,13,14) |
| InChIKey | NCEWOAJICXAFRS-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 125.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.75 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|