C10H11ClN6O2S — CID 114111350
5-chloro-6-hydrazinyl-N-(pyrimidin-4-ylmethyl)pyridine-3-sulfonamide (PubChem CID 114111350) has the molecular formula C10H11ClN6O2S and a molecular weight of 314.76 g/mol. Its IUPAC name is 5-chloro-6-hydrazinyl-N-(pyrimidin-4-ylmethyl)pyridine-3-sulfonamide.
| Compound Name | 5-chloro-6-hydrazinyl-N-(pyrimidin-4-ylmethyl)pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 114111350 |
| Molecular Formula | C10H11ClN6O2S |
| Molecular Weight | 314.76 g/mol |
| Exact Mass | 314.04 |
| IUPAC Name | 5-chloro-6-hydrazinyl-N-(pyrimidin-4-ylmethyl)pyridine-3-sulfonamide |
| SMILES | NNc1ncc(S(=O)(=O)NCc2ccncn2)cc1Cl |
| InChI | InChI=1S/C10H11ClN6O2S/c11-9-3-8(5-14-10(9)17-12)20(18,19)16-4-7-1-2-13-6-15-7/h1-3,5-6,16H,4,12H2,(H,14,17) |
| InChIKey | VTWFDOLBPLQXSZ-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 122.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.76 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|